C23H24N2O3S — CID 9485481
propyl 3-[[(5E)-3-ethyl-5-[(4-methylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 9485481) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is propyl 3-[[(5E)-3-ethyl-5-[(4-methylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | propyl 3-[[(5E)-3-ethyl-5-[(4-methylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 9485481 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | propyl 3-[[(5E)-3-ethyl-5-[(4-methylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCCOC(=O)c1cccc(/N=C2/S/C(=C/c3ccc(C)cc3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-4-13-28-22(27)18-7-6-8-19(15-18)24-23-25(5-2)21(26)20(29-23)14-17-11-9-16(3)10-12-17/h6-12,14-15H,4-5,13H2,1-3H3/b20-14+,24-23+ |
| InChIKey | IZPLEYREZCVULK-TWGQILOBSA-N |
| XLogP | 5.19 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|