C25H27BrN2O4S — CID 3906934
ethyl 3-[[5-[(5-bromo-2-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3906934) has the molecular formula C25H27BrN2O4S and a molecular weight of 531.47 g/mol. Its IUPAC name is ethyl 3-[[5-[(5-bromo-2-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[(5-bromo-2-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3906934 |
| Molecular Formula | C25H27BrN2O4S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | ethyl 3-[[5-[(5-bromo-2-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCCCOc1ccc(Br)cc1C=C1S/C(=N\c2cccc(C(=O)OCC)c2)N(CC)C1=O |
| InChI | InChI=1S/C25H27BrN2O4S/c1-4-7-13-32-21-12-11-19(26)14-18(21)16-22-23(29)28(5-2)25(33-22)27-20-10-8-9-17(15-20)24(30)31-6-3/h8-12,14-16H,4-7,13H2,1-3H3/b22-16?,27-25- |
| InChIKey | XDMVEEANBNJTLN-HDBDFWNXSA-N |
| XLogP | 6.43 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|