C28H24BrClN2O4S — CID 5016792
ethyl 3-[[5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 5016792) has the molecular formula C28H24BrClN2O4S and a molecular weight of 599.93 g/mol. Its IUPAC name is ethyl 3-[[5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5016792 |
| Molecular Formula | C28H24BrClN2O4S |
| Molecular Weight | 599.93 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | ethyl 3-[[5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2\SC(=Cc3ccc(OCc4ccccc4Cl)c(Br)c3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C28H24BrClN2O4S/c1-3-32-26(33)25(37-28(32)31-21-10-7-9-19(16-21)27(34)35-4-2)15-18-12-13-24(22(29)14-18)36-17-20-8-5-6-11-23(20)30/h5-16H,3-4,17H2,1-2H3/b25-15?,31-28- |
| InChIKey | YSTDPTSTYYTBQR-UAXSOMEVSA-N |
| XLogP | 7.48 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.93 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|