C23H23BrN2O5S — CID 4766460
3-[[5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4766460) has the molecular formula C23H23BrN2O5S and a molecular weight of 519.42 g/mol. Its IUPAC name is 3-[[5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4766460 |
| Molecular Formula | C23H23BrN2O5S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 3-[[5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(OCC)c(C=C2S/C(=N\c3cccc(C(=O)O)c3)N(CC)C2=O)cc1Br |
| InChI | InChI=1S/C23H23BrN2O5S/c1-4-26-21(27)20(32-23(26)25-16-9-7-8-14(10-16)22(28)29)12-15-11-17(24)19(31-6-3)13-18(15)30-5-2/h7-13H,4-6H2,1-3H3,(H,28,29)/b20-12?,25-23- |
| InChIKey | GYXMMLNJMAWSCK-OCIWONHHSA-N |
| XLogP | 5.57 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|