C23H23ClN2O4S — CID 126066911
3-[[(5E)-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126066911) has the molecular formula C23H23ClN2O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is 3-[[(5E)-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126066911 |
| Molecular Formula | C23H23ClN2O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3-[[(5E)-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2cc(Cl)ccc2OCC(C)C)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H23ClN2O4S/c1-4-26-21(27)20(12-16-10-17(24)8-9-19(16)30-13-14(2)3)31-23(26)25-18-7-5-6-15(11-18)22(28)29/h5-12,14H,4,13H2,1-3H3,(H,28,29)/b20-12+,25-23- |
| InChIKey | UCJZVIRYKFBWOR-GYOQDEGTSA-N |
| XLogP | 5.70 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|