C26H28ClN3O4S — CID 126165191
(5E)-5-[(5-chloro-2-propoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126165191) has the molecular formula C26H28ClN3O4S and a molecular weight of 514.05 g/mol. Its IUPAC name is (5E)-5-[(5-chloro-2-propoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-chloro-2-propoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126165191 |
| Molecular Formula | C26H28ClN3O4S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | (5E)-5-[(5-chloro-2-propoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCCOc1ccc(Cl)cc1/C=C1/S/C(=N\c2cccc(C(=O)N3CCOCC3)c2)N(CC)C1=O |
| InChI | InChI=1S/C26H28ClN3O4S/c1-3-12-34-22-9-8-20(27)15-19(22)17-23-25(32)30(4-2)26(35-23)28-21-7-5-6-18(16-21)24(31)29-10-13-33-14-11-29/h5-9,15-17H,3-4,10-14H2,1-2H3/b23-17+,28-26- |
| InChIKey | YLUONOQSEPSPLI-AQBZCYANSA-N |
| XLogP | 5.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|