C24H25IN2O5S — CID 5234847
ethyl 3-[[5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 5234847) has the molecular formula C24H25IN2O5S and a molecular weight of 580.44 g/mol. Its IUPAC name is ethyl 3-[[5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5234847 |
| Molecular Formula | C24H25IN2O5S |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | ethyl 3-[[5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2\SC(=Cc3cc(I)c(OCC)c(OC)c3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C24H25IN2O5S/c1-5-27-22(28)20(13-15-11-18(25)21(31-6-2)19(12-15)30-4)33-24(27)26-17-10-8-9-16(14-17)23(29)32-7-3/h8-14H,5-7H2,1-4H3/b20-13?,26-24- |
| InChIKey | KQYUSLCOKBICDI-MYMCYTLDSA-N |
| XLogP | 5.50 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|