C24H23IN2O7S — CID 3983862
methyl 3-[[5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3983862) has the molecular formula C24H23IN2O7S and a molecular weight of 610.43 g/mol. Its IUPAC name is methyl 3-[[5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3983862 |
| Molecular Formula | C24H23IN2O7S |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | methyl 3-[[5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)COc1c(I)cc(C=C2S/C(=N/c3cccc(C(=O)OC)c3)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C24H23IN2O7S/c1-5-33-20(28)13-34-21-17(25)9-14(10-18(21)31-3)11-19-22(29)27(2)24(35-19)26-16-8-6-7-15(12-16)23(30)32-4/h6-12H,5,13H2,1-4H3/b19-11?,26-24+ |
| InChIKey | RADAMZOPXIVTSL-JSEYJXAHSA-N |
| XLogP | 4.26 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|