C24H23IN2O7S — CID 126063945
3-[[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126063945) has the molecular formula C24H23IN2O7S and a molecular weight of 610.43 g/mol. Its IUPAC name is 3-[[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126063945 |
| Molecular Formula | C24H23IN2O7S |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | 3-[[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/S/C(=N\c3cccc(C(=O)O)c3)N(C)C2=O)cc1OCC |
| InChI | InChI=1S/C24H23IN2O7S/c1-4-32-18-10-14(9-17(25)21(18)34-13-20(28)33-5-2)11-19-22(29)27(3)24(35-19)26-16-8-6-7-15(12-16)23(30)31/h6-12H,4-5,13H2,1-3H3,(H,30,31)/b19-11+,26-24- |
| InChIKey | KAVWTNIAJPKATQ-KJEQNGCBSA-N |
| XLogP | 4.56 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|