C26H23N3O7S — CID 3254410
ethyl 3-[[3-ethyl-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3254410) has the molecular formula C26H23N3O7S and a molecular weight of 521.55 g/mol. Its IUPAC name is ethyl 3-[[3-ethyl-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[3-ethyl-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3254410 |
| Molecular Formula | C26H23N3O7S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | ethyl 3-[[3-ethyl-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2/SC(=Cc3ccc(-c4cc([N+](=O)[O-])ccc4OC)o3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C26H23N3O7S/c1-4-28-24(30)23(37-26(28)27-17-8-6-7-16(13-17)25(31)35-5-2)15-19-10-12-22(36-19)20-14-18(29(32)33)9-11-21(20)34-3/h6-15H,4-5H2,1-3H3/b23-15?,27-26+ |
| InChIKey | UYHZEDXDJVPNFR-XSJZENOYSA-N |
| XLogP | 5.66 |
| TPSA | 124.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|