C24H19N3O7S — CID 5189928
3-[[3-ethyl-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 5189928) has the molecular formula C24H19N3O7S and a molecular weight of 493.50 g/mol. Its IUPAC name is 3-[[3-ethyl-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[3-ethyl-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 5189928 |
| Molecular Formula | C24H19N3O7S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 3-[[3-ethyl-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2ccc(-c3ccc(OC)cc3[N+](=O)[O-])o2)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H19N3O7S/c1-3-26-22(28)21(35-24(26)25-15-6-4-5-14(11-15)23(29)30)13-17-8-10-20(34-17)18-9-7-16(33-2)12-19(18)27(31)32/h4-13H,3H2,1-2H3,(H,29,30)/b21-13?,25-24+ |
| InChIKey | VAPKXEONKHIFPA-NMWUNDQBSA-N |
| XLogP | 5.19 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|