C23H18BrN3O5S — CID 126245985
(5Z)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126245985) has the molecular formula C23H18BrN3O5S and a molecular weight of 528.38 g/mol. Its IUPAC name is (5Z)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126245985 |
| Molecular Formula | C23H18BrN3O5S |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | (5Z)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)S/C1=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H18BrN3O5S/c1-3-26-22(28)21(33-23(26)25-14-4-7-16(31-2)8-5-14)13-17-9-11-20(32-17)18-10-6-15(27(29)30)12-19(18)24/h4-13H,3H2,1-2H3/b21-13-,25-23+ |
| InChIKey | FEYNWOLVKIXJIQ-IAUUDGPGSA-N |
| XLogP | 6.25 |
| TPSA | 98.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|