C21H12Br2N2O5S — CID 124667468
(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124667468) has the molecular formula C21H12Br2N2O5S and a molecular weight of 564.21 g/mol. Its IUPAC name is (5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667468 |
| Molecular Formula | C21H12Br2N2O5S |
| Molecular Weight | 564.21 g/mol |
| Exact Mass | 561.88 |
| IUPAC Name | (5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)C(=O)N1Cc1ccccc1Br |
| InChI | InChI=1S/C21H12Br2N2O5S/c22-16-4-2-1-3-12(16)11-24-20(26)19(31-21(24)27)10-14-6-8-18(30-14)15-7-5-13(25(28)29)9-17(15)23/h1-10H,11H2/b19-10+ |
| InChIKey | RWWAEESOFVIOAA-VXLYETTFSA-N |
| XLogP | 6.62 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.21 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|