C24H16BrN3O8S — CID 126210620
2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 126210620) has the molecular formula C24H16BrN3O8S and a molecular weight of 586.38 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 126210620 |
| Molecular Formula | C24H16BrN3O8S |
| Molecular Weight | 586.38 g/mol |
| Exact Mass | 584.98 |
| IUPAC Name | 2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)C1=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H16BrN3O8S/c25-17-10-14(28(32)33)2-4-16(17)18-6-3-15(36-18)11-21-23(30)27(24(31)37-21)12-22(29)26-13-1-5-19-20(9-13)35-8-7-34-19/h1-6,9-11H,7-8,12H2,(H,26,29)/b21-11+ |
| InChIKey | GTDWWEXIWCEBIP-SRZZPIQSSA-N |
| XLogP | 5.06 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|