C26H21ClN4O7S — CID 126153728
2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 126153728) has the molecular formula C26H21ClN4O7S and a molecular weight of 569.00 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126153728 |
| Molecular Formula | C26H21ClN4O7S |
| Molecular Weight | 569.00 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)C1=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H21ClN4O7S/c27-21-7-5-18(31(35)36)13-20(21)22-8-6-19(38-22)14-23-25(33)30(26(34)39-23)15-24(32)28-16-1-3-17(4-2-16)29-9-11-37-12-10-29/h1-8,13-14H,9-12,15H2,(H,28,32)/b23-14+ |
| InChIKey | XWBYSKRAXAQQHB-OEAKJJBVSA-N |
| XLogP | 5.02 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|