C23H15Cl2N3O6S — CID 126283077
N-(5-chloro-2-methylphenyl)-2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126283077) has the molecular formula C23H15Cl2N3O6S and a molecular weight of 532.36 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126283077 |
| Molecular Formula | C23H15Cl2N3O6S |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CN1C(=O)S/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)C1=O |
| InChI | InChI=1S/C23H15Cl2N3O6S/c1-12-2-3-13(24)8-18(12)26-21(29)11-27-22(30)20(35-23(27)31)10-15-5-7-19(34-15)16-9-14(28(32)33)4-6-17(16)25/h2-10H,11H2,1H3,(H,26,29)/b20-10+ |
| InChIKey | XYNDVPJLNIVMRP-KEBDBYFISA-N |
| XLogP | 6.15 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|