C24H16ClF3N2O4S — CID 126201772
N-(5-chloro-2-methylphenyl)-2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126201772) has the molecular formula C24H16ClF3N2O4S and a molecular weight of 520.92 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126201772 |
| Molecular Formula | C24H16ClF3N2O4S |
| Molecular Weight | 520.92 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CN1C(=O)S/C(=C/c2ccc(-c3ccccc3C(F)(F)F)o2)C1=O |
| InChI | InChI=1S/C24H16ClF3N2O4S/c1-13-6-7-14(25)10-18(13)29-21(31)12-30-22(32)20(35-23(30)33)11-15-8-9-19(34-15)16-4-2-3-5-17(16)24(26,27)28/h2-11H,12H2,1H3,(H,29,31)/b20-11+ |
| InChIKey | JBEDDCKEJXKKGQ-RGVLZGJSSA-N |
| XLogP | 6.60 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.92 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|