C23H14F3IN2O4S — CID 126348180
2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126348180) has the molecular formula C23H14F3IN2O4S and a molecular weight of 598.34 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126348180 |
| Molecular Formula | C23H14F3IN2O4S |
| Molecular Weight | 598.34 g/mol |
| Exact Mass | 597.97 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccccc3C(F)(F)F)o2)C1=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C23H14F3IN2O4S/c24-23(25,26)17-4-2-1-3-16(17)18-10-9-15(33-18)11-19-21(31)29(22(32)34-19)12-20(30)28-14-7-5-13(27)6-8-14/h1-11H,12H2,(H,28,30)/b19-11+ |
| InChIKey | CDZINFVQPVEYTM-YBFXNURJSA-N |
| XLogP | 6.24 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|