C21H18F3NO5S — CID 126208829
[(2S)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 126208829) has the molecular formula C21H18F3NO5S and a molecular weight of 453.44 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2S)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126208829 |
| Molecular Formula | C21H18F3NO5S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [(2S)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@H](C)OC(=O)CN1C(=O)S/C(=C/c2ccc(-c3ccccc3C(F)(F)F)o2)C1=O |
| InChI | InChI=1S/C21H18F3NO5S/c1-3-12(2)29-18(26)11-25-19(27)17(31-20(25)28)10-13-8-9-16(30-13)14-6-4-5-7-15(14)21(22,23)24/h4-10,12H,3,11H2,1-2H3/b17-10+/t12-/m0/s1 |
| InChIKey | SATGJSZBCRXYFH-VAKHEIKFSA-N |
| XLogP | 5.34 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|