C24H18ClN3O6S — CID 126278023
2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126278023) has the molecular formula C24H18ClN3O6S and a molecular weight of 511.94 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126278023 |
| Molecular Formula | C24H18ClN3O6S |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-[(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cc([N+](=O)[O-])ccc4Cl)o3)C2=O)c1C |
| InChI | InChI=1S/C24H18ClN3O6S/c1-13-4-3-5-19(14(13)2)26-22(29)12-27-23(30)21(35-24(27)31)11-16-7-9-20(34-16)17-10-15(28(32)33)6-8-18(17)25/h3-11H,12H2,1-2H3,(H,26,29)/b21-11+ |
| InChIKey | DFRKAAHIXQIVSB-SRZZPIQSSA-N |
| XLogP | 5.80 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|