C17H12BrIN2O4S — CID 4772109
3-[[5-[(5-bromo-4-iodofuran-2-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4772109) has the molecular formula C17H12BrIN2O4S and a molecular weight of 547.17 g/mol. Its IUPAC name is 3-[[5-[(5-bromo-4-iodofuran-2-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[(5-bromo-4-iodofuran-2-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4772109 |
| Molecular Formula | C17H12BrIN2O4S |
| Molecular Weight | 547.17 g/mol |
| Exact Mass | 545.87 |
| IUPAC Name | 3-[[5-[(5-bromo-4-iodofuran-2-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2cc(I)c(Br)o2)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H12BrIN2O4S/c1-2-21-15(22)13(8-11-7-12(19)14(18)25-11)26-17(21)20-10-5-3-4-9(6-10)16(23)24/h3-8H,2H2,1H3,(H,23,24)/b13-8?,20-17- |
| InChIKey | BNAKNDVEVUOCDL-MXXBPTPXSA-N |
| XLogP | 4.97 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|