C23H21N3O3S — CID 126074659
3-[[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126074659) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126074659 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-[[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2c(C)n(C)c3ccccc23)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-4-26-21(27)20(13-18-14(2)25(3)19-11-6-5-10-17(18)19)30-23(26)24-16-9-7-8-15(12-16)22(28)29/h5-13H,4H2,1-3H3,(H,28,29)/b20-13+,24-23- |
| InChIKey | LCHJVHBWBWCOSC-PGBYLALNSA-N |
| XLogP | 4.81 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|