C18H16N2O7S — CID 126135337
(5E)-3-(2-methoxyethyl)-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126135337) has the molecular formula C18H16N2O7S and a molecular weight of 404.40 g/mol. Its IUPAC name is (5E)-3-(2-methoxyethyl)-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(2-methoxyethyl)-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135337 |
| Molecular Formula | C18H16N2O7S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (5E)-3-(2-methoxyethyl)-5-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCN1C(=O)S/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3OC)o2)C1=O |
| InChI | InChI=1S/C18H16N2O7S/c1-25-8-7-19-17(21)16(28-18(19)22)10-12-4-6-15(27-12)13-9-11(20(23)24)3-5-14(13)26-2/h3-6,9-10H,7-8H2,1-2H3/b16-10+ |
| InChIKey | QKERAACDCMEZIP-MHWRWJLKSA-N |
| XLogP | 3.55 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|