C17H13Cl2NO4S — CID 126155516
(5Z)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126155516) has the molecular formula C17H13Cl2NO4S and a molecular weight of 398.27 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126155516 |
| Molecular Formula | C17H13Cl2NO4S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | (5Z)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCN1C(=O)S/C(=C\c2ccc(-c3ccc(Cl)cc3Cl)o2)C1=O |
| InChI | InChI=1S/C17H13Cl2NO4S/c1-23-7-6-20-16(21)15(25-17(20)22)9-11-3-5-14(24-11)12-4-2-10(18)8-13(12)19/h2-5,8-9H,6-7H2,1H3/b15-9- |
| InChIKey | ZLRWVBPUUDTRMM-DHDCSXOGSA-N |
| XLogP | 4.94 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|