C26H29N5O5S — CID 3583617
ethyl 3-[[3-ethyl-5-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3583617) has the molecular formula C26H29N5O5S and a molecular weight of 523.62 g/mol. Its IUPAC name is ethyl 3-[[3-ethyl-5-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[3-ethyl-5-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3583617 |
| Molecular Formula | C26H29N5O5S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | ethyl 3-[[3-ethyl-5-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2/SC(=Cc3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C26H29N5O5S/c1-4-30-24(32)23(37-26(30)27-20-8-6-7-18(15-20)25(33)36-5-2)17-19-16-21(31(34)35)9-10-22(19)29-13-11-28(3)12-14-29/h6-10,15-17H,4-5,11-14H2,1-3H3/b23-17?,27-26+ |
| InChIKey | NKAYJPGXFVZPDL-PWNCSSMOSA-N |
| XLogP | 4.15 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|