C25H27N3O3S — CID 4000091
methyl 3-[[3-ethyl-5-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4000091) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is methyl 3-[[3-ethyl-5-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[3-ethyl-5-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4000091 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | methyl 3-[[3-ethyl-5-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCN1C(=O)C(=Cc2ccc(N3CCCC3)cc2C)S/C1=N\c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H27N3O3S/c1-4-28-23(29)22(16-18-10-11-21(14-17(18)2)27-12-5-6-13-27)32-25(28)26-20-9-7-8-19(15-20)24(30)31-3/h7-11,14-16H,4-6,12-13H2,1-3H3/b22-16?,26-25- |
| InChIKey | ZCTNMUOLEVZMRR-RNKSRKJTSA-N |
| XLogP | 5.01 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|