C24H18Cl2N2O4S — CID 6208084
ethyl 4-[[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6208084) has the molecular formula C24H18Cl2N2O4S and a molecular weight of 501.39 g/mol. Its IUPAC name is ethyl 4-[[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6208084 |
| Molecular Formula | C24H18Cl2N2O4S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | ethyl 4-[[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\S/C(=C/c3ccc(-c4ccc(Cl)cc4Cl)o3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O4S/c1-3-31-23(30)14-4-7-16(8-5-14)27-24-28(2)22(29)21(33-24)13-17-9-11-20(32-17)18-10-6-15(25)12-19(18)26/h4-13H,3H2,1-2H3/b21-13+,27-24- |
| InChIKey | BLPPHEQSPLRLRQ-CIFGJUBISA-N |
| XLogP | 6.66 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|