C18H13Cl2NO4S2 — CID 74373688
ethyl 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 74373688) has the molecular formula C18H13Cl2NO4S2 and a molecular weight of 442.35 g/mol. Its IUPAC name is ethyl 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 74373688 |
| Molecular Formula | C18H13Cl2NO4S2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | ethyl 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)SC1=S |
| InChI | InChI=1S/C18H13Cl2NO4S2/c1-2-24-16(22)9-21-17(23)15(27-18(21)26)8-11-4-6-14(25-11)12-5-3-10(19)7-13(12)20/h3-8H,2,9H2,1H3 |
| InChIKey | SBRAESOZOBJTST-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|