C20H18Cl2N2O3S2 — CID 1205977
2-[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N,N-diethylacetamide (PubChem CID 1205977) has the molecular formula C20H18Cl2N2O3S2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N,N-diethylacetamide.
| Compound Name | 2-[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 1205977 |
| Molecular Formula | C20H18Cl2N2O3S2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2-[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)C(=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)SC1=S |
| InChI | InChI=1S/C20H18Cl2N2O3S2/c1-3-23(4-2)18(25)11-24-19(26)17(29-20(24)28)10-13-6-8-16(27-13)14-9-12(21)5-7-15(14)22/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | AZUOMAGCANKCBZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|