C16H7Cl3NO4S2- — CID 2190405
2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 2190405) has the molecular formula C16H7Cl3NO4S2- and a molecular weight of 447.73 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 2190405 |
| Molecular Formula | C16H7Cl3NO4S2- |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)/C(=C/c2ccc(-c3cc(Cl)c(Cl)cc3Cl)o2)SC1=S |
| InChI | InChI=1S/C16H8Cl3NO4S2/c17-9-5-11(19)10(18)4-8(9)12-2-1-7(24-12)3-13-15(23)20(6-14(21)22)16(25)26-13/h1-5H,6H2,(H,21,22)/p-1/b13-3- |
| InChIKey | QJOKGSGICJCVFI-DXNYSGJVSA-M |
| XLogP | 3.86 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|