C26H24N2O4S — CID 5224788
ethyl 3-[5-[[2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 5224788) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is ethyl 3-[5-[[2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[[2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 5224788 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | ethyl 3-[5-[[2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(C=C3S/C(=N/c4ccc(C)c(C)c4)N(C)C3=O)o2)c1 |
| InChI | InChI=1S/C26H24N2O4S/c1-5-31-25(30)19-8-6-7-18(14-19)22-12-11-21(32-22)15-23-24(29)28(4)26(33-23)27-20-10-9-16(2)17(3)13-20/h6-15H,5H2,1-4H3/b23-15?,27-26+ |
| InChIKey | MWWRZIRMALGKOU-XSJZENOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|