C24H19N3O6S — CID 126176859
methyl 4-[[(5E)-3-methyl-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 126176859) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is methyl 4-[[(5E)-3-methyl-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5E)-3-methyl-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 126176859 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | methyl 4-[[(5E)-3-methyl-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2\S/C(=C/c3ccc(-c4ccc([N+](=O)[O-])cc4C)o3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C24H19N3O6S/c1-14-12-17(27(30)31)8-10-19(14)20-11-9-18(33-20)13-21-22(28)26(2)24(34-21)25-16-6-4-15(5-7-16)23(29)32-3/h4-13H,1-3H3/b21-13+,25-24- |
| InChIKey | WLJZCKNSGWINHS-XHFTXJRRSA-N |
| XLogP | 5.18 |
| TPSA | 115.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|