C31H27N3O4S — CID 6002812
(5E)-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 6002812) has the molecular formula C31H27N3O4S and a molecular weight of 537.64 g/mol. Its IUPAC name is (5E)-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6002812 |
| Molecular Formula | C31H27N3O4S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | (5E)-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-5-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccccc1/N=C1\S/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3C)o2)C(=O)N1c1ccccc1CC |
| InChI | InChI=1S/C31H27N3O4S/c1-4-21-10-6-8-12-26(21)32-31-33(27-13-9-7-11-22(27)5-2)30(35)29(39-31)19-24-15-17-28(38-24)25-16-14-23(34(36)37)18-20(25)3/h6-19H,4-5H2,1-3H3/b29-19+,32-31- |
| InChIKey | DIBBTWJWQDCQPY-KQDKSACUSA-N |
| XLogP | 8.10 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|