C23H16Cl2N2O4S — CID 4765807
4-[[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4765807) has the molecular formula C23H16Cl2N2O4S and a molecular weight of 487.36 g/mol. Its IUPAC name is 4-[[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4765807 |
| Molecular Formula | C23H16Cl2N2O4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 4-[[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)S/C1=N\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H16Cl2N2O4S/c1-2-27-21(28)20(32-23(27)26-15-6-3-13(4-7-15)22(29)30)12-16-8-10-19(31-16)17-9-5-14(24)11-18(17)25/h3-12H,2H2,1H3,(H,29,30)/b20-12?,26-23- |
| InChIKey | ZXNSNSDTCQZRRX-FERUUYQASA-N |
| XLogP | 6.58 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|