C23H15BrCl2N2O4S — CID 126027342
5-[5-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 126027342) has the molecular formula C23H15BrCl2N2O4S and a molecular weight of 566.26 g/mol. Its IUPAC name is 5-[5-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[5-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126027342 |
| Molecular Formula | C23H15BrCl2N2O4S |
| Molecular Weight | 566.26 g/mol |
| Exact Mass | 563.93 |
| IUPAC Name | 5-[5-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)S/C1=N\c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C23H15BrCl2N2O4S/c1-2-28-21(29)20(33-23(28)27-13-4-6-16(24)18(26)10-13)11-14-5-8-19(32-14)12-3-7-17(25)15(9-12)22(30)31/h3-11H,2H2,1H3,(H,30,31)/b20-11+,27-23- |
| InChIKey | SWPZEZOOHHWRBY-YRTYMPHOSA-N |
| XLogP | 7.34 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.26 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|