C22H16BrClN2O2S2 — CID 126093338
(5E)-2-(4-bromo-3-chlorophenyl)imino-3-ethyl-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126093338) has the molecular formula C22H16BrClN2O2S2 and a molecular weight of 519.87 g/mol. Its IUPAC name is (5E)-2-(4-bromo-3-chlorophenyl)imino-3-ethyl-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-3-ethyl-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126093338 |
| Molecular Formula | C22H16BrClN2O2S2 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-3-ethyl-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(Sc3ccccc3)o2)S/C1=N/c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C22H16BrClN2O2S2/c1-2-26-21(27)19(30-22(26)25-14-8-10-17(23)18(24)12-14)13-15-9-11-20(28-15)29-16-6-4-3-5-7-16/h3-13H,2H2,1H3/b19-13+,25-22+ |
| InChIKey | SISGTTNSAYKCTL-KZWMQRDFSA-N |
| XLogP | 7.47 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|