C22H15BrClFN2O2S2 — CID 126237146
(5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126237146) has the molecular formula C22H15BrClFN2O2S2 and a molecular weight of 537.86 g/mol. Its IUPAC name is (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126237146 |
| Molecular Formula | C22H15BrClFN2O2S2 |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 535.94 |
| IUPAC Name | (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(Sc3ccc(Cl)cc3)o2)S/C1=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15BrClFN2O2S2/c1-2-27-20(28)19(31-22(27)26-15-7-5-14(25)6-8-15)12-16-11-18(23)21(29-16)30-17-9-3-13(24)4-10-17/h3-12H,2H2,1H3/b19-12+,26-22+ |
| InChIKey | HFAODKKKJAPYNF-MPYYLAFLSA-N |
| XLogP | 7.61 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|