C20H15Br2FN2O4S — CID 126247318
2-[2,6-dibromo-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126247318) has the molecular formula C20H15Br2FN2O4S and a molecular weight of 558.22 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126247318 |
| Molecular Formula | C20H15Br2FN2O4S |
| Molecular Weight | 558.22 g/mol |
| Exact Mass | 555.91 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCC(=O)O)c(Br)c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15Br2FN2O4S/c1-2-25-19(28)16(30-20(25)24-13-5-3-12(23)4-6-13)9-11-7-14(21)18(15(22)8-11)29-10-17(26)27/h3-9H,2,10H2,1H3,(H,26,27)/b16-9+,24-20- |
| InChIKey | IZHKQUFRSVBUIP-RQEWAXFTSA-N |
| XLogP | 5.44 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.22 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|