C28H21BrN2O2S2 — CID 126006179
(5Z)-3-benzyl-2-benzylimino-5-[(4-bromo-5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126006179) has the molecular formula C28H21BrN2O2S2 and a molecular weight of 561.53 g/mol. Its IUPAC name is (5Z)-3-benzyl-2-benzylimino-5-[(4-bromo-5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-2-benzylimino-5-[(4-bromo-5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126006179 |
| Molecular Formula | C28H21BrN2O2S2 |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | (5Z)-3-benzyl-2-benzylimino-5-[(4-bromo-5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(Sc3ccccc3)o2)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H21BrN2O2S2/c29-24-16-22(33-27(24)34-23-14-8-3-9-15-23)17-25-26(32)31(19-21-12-6-2-7-13-21)28(35-25)30-18-20-10-4-1-5-11-20/h1-17H,18-19H2/b25-17-,30-28- |
| InChIKey | UXGZPZUQWLJDGF-SDOFRJHVSA-N |
| XLogP | 7.87 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|