C26H20N4O2S2 — CID 1210495
3-benzyl-2-benzylimino-5-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 1210495) has the molecular formula C26H20N4O2S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 3-benzyl-2-benzylimino-5-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-2-benzylimino-5-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1210495 |
| Molecular Formula | C26H20N4O2S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 3-benzyl-2-benzylimino-5-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(Sc3ncccn3)o2)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H20N4O2S2/c31-24-22(16-21-12-13-23(32-21)34-25-27-14-7-15-28-25)33-26(29-17-19-8-3-1-4-9-19)30(24)18-20-10-5-2-6-11-20/h1-16H,17-18H2/b22-16?,29-26- |
| InChIKey | IUHIZZALYBMSOJ-MQHLRHHASA-N |
| XLogP | 5.89 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|