C33H23F3N4O2S2 — CID 126282572
(5E)-3-benzyl-2-benzylimino-5-[[5-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126282572) has the molecular formula C33H23F3N4O2S2 and a molecular weight of 628.70 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[[5-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[[5-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126282572 |
| Molecular Formula | C33H23F3N4O2S2 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[[5-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylfuran-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(Sc3nc(-c4ccccc4)cc(C(F)(F)F)n3)o2)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H23F3N4O2S2/c34-33(35,36)28-19-26(24-14-8-3-9-15-24)38-31(39-28)44-29-17-16-25(42-29)18-27-30(41)40(21-23-12-6-2-7-13-23)32(43-27)37-20-22-10-4-1-5-11-22/h1-19H,20-21H2/b27-18+,37-32- |
| InChIKey | QSDUHUSQRXRIKP-YKCNQTHKSA-N |
| XLogP | 8.58 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|