C32H30N2O2S — CID 135024367
(5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-(3-phenylpropyl)-2-(3-phenylpropylimino)-1,3-thiazolidin-4-one (PubChem CID 135024367) has the molecular formula C32H30N2O2S and a molecular weight of 506.67 g/mol. Its IUPAC name is (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-(3-phenylpropyl)-2-(3-phenylpropylimino)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-(3-phenylpropyl)-2-(3-phenylpropylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135024367 |
| Molecular Formula | C32H30N2O2S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-(3-phenylpropyl)-2-(3-phenylpropylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)o2)S/C(=N\CCCc2ccccc2)N1CCCc1ccccc1 |
| InChI | InChI=1S/C32H30N2O2S/c35-31-30(24-28-20-21-29(36-28)27-18-8-3-9-19-27)37-32(33-22-10-16-25-12-4-1-5-13-25)34(31)23-11-17-26-14-6-2-7-15-26/h1-9,12-15,18-21,24H,10-11,16-17,22-23H2/b30-24-,33-32- |
| InChIKey | DAKQFISIRIBFIV-FSVJXVEZSA-N |
| XLogP | 7.48 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|