C23H19NO3S2 — CID 126149900
(5E)-3-(3-phenylpropyl)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126149900) has the molecular formula C23H19NO3S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (5E)-3-(3-phenylpropyl)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-phenylpropyl)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126149900 |
| Molecular Formula | C23H19NO3S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (5E)-3-(3-phenylpropyl)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(Sc3ccccc3)o2)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C23H19NO3S2/c25-22-20(16-18-13-14-21(27-18)28-19-11-5-2-6-12-19)29-23(26)24(22)15-7-10-17-8-3-1-4-9-17/h1-6,8-9,11-14,16H,7,10,15H2/b20-16+ |
| InChIKey | MTOHSCHGNDVQBM-CAPFRKAQSA-N |
| XLogP | 6.10 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|