C20H19NO5S2 — CID 126210097
butyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 126210097) has the molecular formula C20H19NO5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is butyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126210097 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | butyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C\c2ccc(Sc3ccccc3)o2)C1=O |
| InChI | InChI=1S/C20H19NO5S2/c1-2-3-11-25-17(22)13-21-19(23)16(28-20(21)24)12-14-9-10-18(26-14)27-15-7-5-4-6-8-15/h4-10,12H,2-3,11,13H2,1H3/b16-12- |
| InChIKey | ZNQNTLQHCZDNPX-VBKFSLOCSA-N |
| XLogP | 4.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|