C18H15NO5S2 — CID 2289587
ethyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 2289587) has the molecular formula C18H15NO5S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is ethyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 2289587 |
| Molecular Formula | C18H15NO5S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | ethyl 2-[(5Z)-2,4-dioxo-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C\c2ccc(Sc3ccccc3)o2)C1=O |
| InChI | InChI=1S/C18H15NO5S2/c1-2-23-15(20)11-19-17(21)14(26-18(19)22)10-12-8-9-16(24-12)25-13-6-4-3-5-7-13/h3-10H,2,11H2,1H3/b14-10- |
| InChIKey | MHNBREYZXGPNIT-UVTDQMKNSA-N |
| XLogP | 4.03 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|