C20H17ClN2O4S2 — CID 5294378
(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 5294378) has the molecular formula C20H17ClN2O4S2 and a molecular weight of 448.95 g/mol. Its IUPAC name is (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 5294378 |
| Molecular Formula | C20H17ClN2O4S2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Sc3ccc(Cl)cc3)o2)C1=O)N1CCCC1 |
| InChI | InChI=1S/C20H17ClN2O4S2/c21-13-3-6-15(7-4-13)28-18-8-5-14(27-18)11-16-19(25)23(20(26)29-16)12-17(24)22-9-1-2-10-22/h3-8,11H,1-2,9-10,12H2/b16-11+ |
| InChIKey | FFNXWIYISIQWGH-LFIBNONCSA-N |
| XLogP | 4.74 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|