C22H20BrClN2O4S — CID 3319583
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3319583) has the molecular formula C22H20BrClN2O4S and a molecular weight of 523.84 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3319583 |
| Molecular Formula | C22H20BrClN2O4S |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(-c3ccc(Br)c(Cl)c3)o2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C22H20BrClN2O4S/c23-16-7-5-14(11-17(16)24)18-8-6-15(30-18)12-19-21(28)26(22(29)31-19)13-20(27)25-9-3-1-2-4-10-25/h5-8,11-12H,1-4,9-10,13H2 |
| InChIKey | OHTQYHSYAGZLPT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|