C17H11Cl2NO5S — CID 11246917
3-[(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 11246917) has the molecular formula C17H11Cl2NO5S and a molecular weight of 412.25 g/mol. Its IUPAC name is 3-[(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11246917 |
| Molecular Formula | C17H11Cl2NO5S |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 3-[(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)S/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)C1=O |
| InChI | InChI=1S/C17H11Cl2NO5S/c18-11-3-1-9(7-12(11)19)13-4-2-10(25-13)8-14-16(23)20(17(24)26-14)6-5-15(21)22/h1-4,7-8H,5-6H2,(H,21,22)/b14-8- |
| InChIKey | NGUHWNDPQCIFAG-ZSOIEALJSA-N |
| XLogP | 4.76 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|