C20H16Cl2N2O5S2 — CID 58642490
methyl 2-[3-[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate (PubChem CID 58642490) has the molecular formula C20H16Cl2N2O5S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is methyl 2-[3-[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate.
| Compound Name | methyl 2-[3-[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 58642490 |
| Molecular Formula | C20H16Cl2N2O5S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | methyl 2-[3-[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate |
| SMILES | COC(=O)CNC(=O)CCN1C(=O)/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)SC1=S |
| InChI | InChI=1S/C20H16Cl2N2O5S2/c1-28-18(26)10-23-17(25)6-7-24-19(27)16(31-20(24)30)9-12-3-5-15(29-12)11-2-4-13(21)14(22)8-11/h2-5,8-9H,6-7,10H2,1H3,(H,23,25)/b16-9+ |
| InChIKey | GONBKVWMMYFQHV-CXUHLZMHSA-N |
| XLogP | 4.13 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|