C21H13Cl2NO6S — CID 4045144
methyl 5-[[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 4045144) has the molecular formula C21H13Cl2NO6S and a molecular weight of 478.31 g/mol. Its IUPAC name is methyl 5-[[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4045144 |
| Molecular Formula | C21H13Cl2NO6S |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | methyl 5-[[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3ccc(-c4ccc(Cl)c(Cl)c4)o3)C2=O)o1 |
| InChI | InChI=1S/C21H13Cl2NO6S/c1-28-20(26)17-7-4-13(30-17)10-24-19(25)18(31-21(24)27)9-12-3-6-16(29-12)11-2-5-14(22)15(23)8-11/h2-9H,10H2,1H3 |
| InChIKey | URDPMRABYLPWGN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|